C27H26Cl3FN2OSi — CID 24779978
5-chloro-N-[2-(3,4-dichlorophenyl)ethyl]-6-fluoro-N-[(4-trimethylsilylphenyl)methyl]-1H-indole-7-carboxamide (PubChem CID 24779978) has the molecular formula C27H26Cl3FN2OSi and a molecular weight of 547.96 g/mol. Its IUPAC name is 5-chloro-N-[2-(3,4-dichlorophenyl)ethyl]-6-fluoro-N-[(4-trimethylsilylphenyl)methyl]-1H-indole-7-carboxamide.
| Compound Name | 5-chloro-N-[2-(3,4-dichlorophenyl)ethyl]-6-fluoro-N-[(4-trimethylsilylphenyl)methyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 24779978 |
| Molecular Formula | C27H26Cl3FN2OSi |
| Molecular Weight | 547.96 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | 5-chloro-N-[2-(3,4-dichlorophenyl)ethyl]-6-fluoro-N-[(4-trimethylsilylphenyl)methyl]-1H-indole-7-carboxamide |
| SMILES | C[Si](C)(C)c1ccc(CN(CCc2ccc(Cl)c(Cl)c2)C(=O)c2c(F)c(Cl)cc3cc[nH]c23)cc1 |
| InChI | InChI=1S/C27H26Cl3FN2OSi/c1-35(2,3)20-7-4-18(5-8-20)16-33(13-11-17-6-9-21(28)22(29)14-17)27(34)24-25(31)23(30)15-19-10-12-32-26(19)24/h4-10,12,14-15,32H,11,13,16H2,1-3H3 |
| InChIKey | GEYJXUWXDOXCOT-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.96 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|