C22H19F6N3O2 — CID 24780152
(5S,6S,8R)-5-[(7,8-difluoro-2-methylquinazolin-5-yl)amino]-8-ethyl-2-fluoro-6-(trifluoromethyl)-7,8-dihydro-5H-naphthalene-1,6-diol (PubChem CID 24780152) has the molecular formula C22H19F6N3O2 and a molecular weight of 471.40 g/mol. Its IUPAC name is (5S,6S,8R)-5-[(7,8-difluoro-2-methylquinazolin-5-yl)amino]-8-ethyl-2-fluoro-6-(trifluoromethyl)-7,8-dihydro-5H-naphthalene-1,6-diol.
| Compound Name | (5S,6S,8R)-5-[(7,8-difluoro-2-methylquinazolin-5-yl)amino]-8-ethyl-2-fluoro-6-(trifluoromethyl)-7,8-dihydro-5H-naphthalene-1,6-diol |
|---|---|
| PubChem CID | 24780152 |
| Molecular Formula | C22H19F6N3O2 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | (5S,6S,8R)-5-[(7,8-difluoro-2-methylquinazolin-5-yl)amino]-8-ethyl-2-fluoro-6-(trifluoromethyl)-7,8-dihydro-5H-naphthalene-1,6-diol |
| SMILES | CC[C@@H]1C[C@@](O)(C(F)(F)F)[C@@H](Nc2cc(F)c(F)c3nc(C)ncc23)c2ccc(F)c(O)c21 |
| InChI | InChI=1S/C22H19F6N3O2/c1-3-10-7-21(33,22(26,27)28)20(11-4-5-13(23)19(32)16(10)11)31-15-6-14(24)17(25)18-12(15)8-29-9(2)30-18/h4-6,8,10,20,31-33H,3,7H2,1-2H3/t10-,20+,21+/m1/s1 |
| InChIKey | MPPJLIRDMQREPD-MJXXYCQPSA-N |
| XLogP | 5.41 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |