C22H19ClF5N3O2 — CID 87538622
(5R,6R)-2-chloro-5-[(7,8-difluoro-2-methylquinazolin-5-yl)amino]-8,8-dimethyl-6-(trifluoromethyl)-5,7-dihydronaphthalene-1,6-diol (PubChem CID 87538622) has the molecular formula C22H19ClF5N3O2 and a molecular weight of 487.86 g/mol. Its IUPAC name is (5R,6R)-2-chloro-5-[(7,8-difluoro-2-methylquinazolin-5-yl)amino]-8,8-dimethyl-6-(trifluoromethyl)-5,7-dihydronaphthalene-1,6-diol.
| Compound Name | (5R,6R)-2-chloro-5-[(7,8-difluoro-2-methylquinazolin-5-yl)amino]-8,8-dimethyl-6-(trifluoromethyl)-5,7-dihydronaphthalene-1,6-diol |
|---|---|
| PubChem CID | 87538622 |
| Molecular Formula | C22H19ClF5N3O2 |
| Molecular Weight | 487.86 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | (5R,6R)-2-chloro-5-[(7,8-difluoro-2-methylquinazolin-5-yl)amino]-8,8-dimethyl-6-(trifluoromethyl)-5,7-dihydronaphthalene-1,6-diol |
| SMILES | Cc1ncc2c(N[C@@H]3c4ccc(Cl)c(O)c4C(C)(C)C[C@]3(O)C(F)(F)F)cc(F)c(F)c2n1 |
| InChI | InChI=1S/C22H19ClF5N3O2/c1-9-29-7-11-14(6-13(24)16(25)17(11)30-9)31-19-10-4-5-12(23)18(32)15(10)20(2,3)8-21(19,33)22(26,27)28/h4-7,19,31-33H,8H2,1-3H3/t19-,21-/m1/s1 |
| InChIKey | ZSBKBHYZQOEYAG-TZIWHRDSSA-N |
| XLogP | 5.70 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.86 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |