C23H21ClF5N3O2 — CID 87538486
2-chloro-8,8-dimethyl-5-[(2-methylquinazolin-5-yl)amino]-6-(1,1,2,2,2-pentafluoroethyl)-5,7-dihydronaphthalene-1,6-diol (PubChem CID 87538486) has the molecular formula C23H21ClF5N3O2 and a molecular weight of 501.88 g/mol. Its IUPAC name is 2-chloro-8,8-dimethyl-5-[(2-methylquinazolin-5-yl)amino]-6-(1,1,2,2,2-pentafluoroethyl)-5,7-dihydronaphthalene-1,6-diol.
| Compound Name | 2-chloro-8,8-dimethyl-5-[(2-methylquinazolin-5-yl)amino]-6-(1,1,2,2,2-pentafluoroethyl)-5,7-dihydronaphthalene-1,6-diol |
|---|---|
| PubChem CID | 87538486 |
| Molecular Formula | C23H21ClF5N3O2 |
| Molecular Weight | 501.88 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 2-chloro-8,8-dimethyl-5-[(2-methylquinazolin-5-yl)amino]-6-(1,1,2,2,2-pentafluoroethyl)-5,7-dihydronaphthalene-1,6-diol |
| SMILES | Cc1ncc2c(NC3c4ccc(Cl)c(O)c4C(C)(C)CC3(O)C(F)(F)C(F)(F)F)cccc2n1 |
| InChI | InChI=1S/C23H21ClF5N3O2/c1-11-30-9-13-15(31-11)5-4-6-16(13)32-19-12-7-8-14(24)18(33)17(12)20(2,3)10-21(19,34)22(25,26)23(27,28)29/h4-9,19,32-34H,10H2,1-3H3 |
| InChIKey | IVCACQNHCRSMLP-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.88 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|