C19H25N3O2 — CID 24782058
1'-(4-imidazol-1-ylbutyl)-1-methoxyspiro[1H-2-benzofuran-3,3'-pyrrolidine] (PubChem CID 24782058) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 1'-(4-imidazol-1-ylbutyl)-1-methoxyspiro[1H-2-benzofuran-3,3'-pyrrolidine].
| Compound Name | 1'-(4-imidazol-1-ylbutyl)-1-methoxyspiro[1H-2-benzofuran-3,3'-pyrrolidine] |
|---|---|
| PubChem CID | 24782058 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 1'-(4-imidazol-1-ylbutyl)-1-methoxyspiro[1H-2-benzofuran-3,3'-pyrrolidine] |
| SMILES | COC1OC2(CCN(CCCCn3ccnc3)C2)c2ccccc21 |
| InChI | InChI=1S/C19H25N3O2/c1-23-18-16-6-2-3-7-17(16)19(24-18)8-12-21(14-19)10-4-5-11-22-13-9-20-15-22/h2-3,6-7,9,13,15,18H,4-5,8,10-12,14H2,1H3 |
| InChIKey | VXHNMCCMEHPVPA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|