C21H27NO3 — CID 24782355
(4aR,7S,7aR,12bS)-3-(cyclopropylmethyl)-4a-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol (PubChem CID 24782355) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is (4aR,7S,7aR,12bS)-3-(cyclopropylmethyl)-4a-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol.
| Compound Name | (4aR,7S,7aR,12bS)-3-(cyclopropylmethyl)-4a-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol |
|---|---|
| PubChem CID | 24782355 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (4aR,7S,7aR,12bS)-3-(cyclopropylmethyl)-4a-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol |
| SMILES | C[C@@]12CC[C@H](O)[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(CC1CC1)C2C5 |
| InChI | InChI=1S/C21H27NO3/c1-20-7-6-15(24)19-21(20)8-9-22(11-12-2-3-12)16(20)10-13-4-5-14(23)18(25-19)17(13)21/h4-5,12,15-16,19,23-24H,2-3,6-11H2,1H3/t15-,16?,19-,20-,21-/m0/s1 |
| InChIKey | IWCSTILUDVXTJU-AOLWWXSBSA-N |
| XLogP | 2.59 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |