C22H30N2O3 — CID 70220982
(4R,4aS,5S,7S,7aR,12bS)-3-(cyclopropylmethyl)-5-methyl-7-(methylamino)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 70220982) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is (4R,4aS,5S,7S,7aR,12bS)-3-(cyclopropylmethyl)-5-methyl-7-(methylamino)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4R,4aS,5S,7S,7aR,12bS)-3-(cyclopropylmethyl)-5-methyl-7-(methylamino)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 70220982 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | (4R,4aS,5S,7S,7aR,12bS)-3-(cyclopropylmethyl)-5-methyl-7-(methylamino)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | CN[C@H]1C[C@H](C)[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C22H30N2O3/c1-12-9-15(23-2)20-21-7-8-24(11-13-3-4-13)17(22(12,21)26)10-14-5-6-16(25)19(27-20)18(14)21/h5-6,12-13,15,17,20,23,25-26H,3-4,7-11H2,1-2H3/t12-,15-,17+,20-,21-,22+/m0/s1 |
| InChIKey | ZGNFGGUDQSODHW-KCQOJPQBSA-N |
| XLogP | 1.79 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |