C20H24N2O4 — CID 10269653
(4aR,7aR,12bS)-5-amino-3-(cyclopropylmethyl)-4a,9-dihydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 10269653) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is (4aR,7aR,12bS)-5-amino-3-(cyclopropylmethyl)-4a,9-dihydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4aR,7aR,12bS)-5-amino-3-(cyclopropylmethyl)-4a,9-dihydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 10269653 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (4aR,7aR,12bS)-5-amino-3-(cyclopropylmethyl)-4a,9-dihydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | NC1CC(=O)[C@@H]2Oc3c(O)ccc4c3[C@@]23CCN(CC2CC2)C(C4)[C@]13O |
| InChI | InChI=1S/C20H24N2O4/c21-14-8-13(24)18-19-5-6-22(9-10-1-2-10)15(20(14,19)25)7-11-3-4-12(23)17(26-18)16(11)19/h3-4,10,14-15,18,23,25H,1-2,5-9,21H2/t14?,15?,18-,19-,20+/m0/s1 |
| InChIKey | HJDRWOQAJUWRDO-ULDLNYQNSA-N |
| XLogP | 0.46 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |