About N-(3,3-dimethylbutyl)-N-ethyl-2-(7-methoxy-2-oxo-3-phenylquinolin-1-yl)acetamide
N-(3,3-dimethylbutyl)-N-ethyl-2-(7-methoxy-2-oxo-3-phenylquinolin-1-yl)acetamide (PubChem CID 24782579) has the molecular formula C26H32N2O3
and a molecular weight of 420.55 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-N-ethyl-2-(7-methoxy-2-oxo-3-phenylquinolin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(3,3-dimethylbutyl)-N-ethyl-2-(7-methoxy-2-oxo-3-phenylquinolin-1-yl)acetamide |
| PubChem CID | 24782579 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | N-(3,3-dimethylbutyl)-N-ethyl-2-(7-methoxy-2-oxo-3-phenylquinolin-1-yl)acetamide |
| SMILES | CCN(CCC(C)(C)C)C(=O)Cn1c(=O)c(-c2ccccc2)cc2ccc(OC)cc21 |
| InChI | InChI=1S/C26H32N2O3/c1-6-27(15-14-26(2,3)4)24(29)18-28-23-17-21(31-5)13-12-20(23)16-22(25(28)30)19-10-8-7-9-11-19/h7-13,16-17H,6,14-15,18H2,1-5H3 |
| InChIKey | GVIFFDXOPNCNMM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3,3-dimethylbutyl)-N-ethyl-2-(7-methoxy-2-oxo-3-phenylquinolin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethylbutyl)-N-ethyl-2-(7-methoxy-2-oxo-3-phenylquinolin-1-yl)acetamide?
The IUPAC name of N-(3,3-dimethylbutyl)-N-ethyl-2-(7-methoxy-2-oxo-3-phenylquinolin-1-yl)acetamide (CID 24782579) is N-(3,3-dimethylbutyl)-N-ethyl-2-(7-methoxy-2-oxo-3-phenylquinolin-1-yl)acetamide.
What is the SMILES notation for N-(3,3-dimethylbutyl)-N-ethyl-2-(7-methoxy-2-oxo-3-phenylquinolin-1-yl)acetamide?
The canonical SMILES for N-(3,3-dimethylbutyl)-N-ethyl-2-(7-methoxy-2-oxo-3-phenylquinolin-1-yl)acetamide is CCN(CCC(C)(C)C)C(=O)Cn1c(=O)c(-c2ccccc2)cc2ccc(OC)cc21.
What is the InChIKey of N-(3,3-dimethylbutyl)-N-ethyl-2-(7-methoxy-2-oxo-3-phenylquinolin-1-yl)acetamide?
The InChIKey is GVIFFDXOPNCNMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N2O3/c1-6-27(15-14-26(2,3)4)24(29)18-28-23-17-21(31-5)13-12-20(23)16-22(25(28)30)19-10-8-7-9-11-19/h7-13,16-17H,6,14-15,18H2,1-5H3.
What are the key properties of N-(3,3-dimethylbutyl)-N-ethyl-2-(7-methoxy-2-oxo-3-phenylquinolin-1-yl)acetamide?
N-(3,3-dimethylbutyl)-N-ethyl-2-(7-methoxy-2-oxo-3-phenylquinolin-1-yl)acetamide has a molecular weight of 420.55 g/mol, XLogP of 4.96, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethylbutyl)-N-ethyl-2-(7-methoxy-2-oxo-3-phenylquinolin-1-yl)acetamide is sourced from PubChem (CID 24782579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).