C24H36N2O3 — CID 24782581
2-(3-ethyl-7-methoxy-2-oxoquinolin-1-yl)-N,N-bis(3-methylbutyl)acetamide (PubChem CID 24782581) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is 2-(3-ethyl-7-methoxy-2-oxoquinolin-1-yl)-N,N-bis(3-methylbutyl)acetamide.
| Compound Name | 2-(3-ethyl-7-methoxy-2-oxoquinolin-1-yl)-N,N-bis(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 24782581 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | 2-(3-ethyl-7-methoxy-2-oxoquinolin-1-yl)-N,N-bis(3-methylbutyl)acetamide |
| SMILES | CCc1cc2ccc(OC)cc2n(CC(=O)N(CCC(C)C)CCC(C)C)c1=O |
| InChI | InChI=1S/C24H36N2O3/c1-7-19-14-20-8-9-21(29-6)15-22(20)26(24(19)28)16-23(27)25(12-10-17(2)3)13-11-18(4)5/h8-9,14-15,17-18H,7,10-13,16H2,1-6H3 |
| InChIKey | QPIFKPCEVUFPRP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |