C26H36N2O3 — CID 24785892
N-cyclohexyl-2-(3-cyclohexyl-7-methoxy-2-oxoquinolin-1-yl)-N-ethylacetamide (PubChem CID 24785892) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-cyclohexyl-2-(3-cyclohexyl-7-methoxy-2-oxoquinolin-1-yl)-N-ethylacetamide.
| Compound Name | N-cyclohexyl-2-(3-cyclohexyl-7-methoxy-2-oxoquinolin-1-yl)-N-ethylacetamide |
|---|---|
| PubChem CID | 24785892 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | N-cyclohexyl-2-(3-cyclohexyl-7-methoxy-2-oxoquinolin-1-yl)-N-ethylacetamide |
| SMILES | CCN(C(=O)Cn1c(=O)c(C2CCCCC2)cc2ccc(OC)cc21)C1CCCCC1 |
| InChI | InChI=1S/C26H36N2O3/c1-3-27(21-12-8-5-9-13-21)25(29)18-28-24-17-22(31-2)15-14-20(24)16-23(26(28)30)19-10-6-4-7-11-19/h14-17,19,21H,3-13,18H2,1-2H3 |
| InChIKey | XYTKHUYNTUDJAD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |