C27H28F3NO — CID 24782915
4-[[3-(3-methylphenyl)-5-(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidine (PubChem CID 24782915) has the molecular formula C27H28F3NO and a molecular weight of 439.52 g/mol. Its IUPAC name is 4-[[3-(3-methylphenyl)-5-(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidine.
| Compound Name | 4-[[3-(3-methylphenyl)-5-(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidine |
|---|---|
| PubChem CID | 24782915 |
| Molecular Formula | C27H28F3NO |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 4-[[3-(3-methylphenyl)-5-(trifluoromethyl)phenyl]methoxymethyl]-4-phenylpiperidine |
| SMILES | Cc1cccc(-c2cc(COCC3(c4ccccc4)CCNCC3)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C27H28F3NO/c1-20-6-5-7-22(14-20)23-15-21(16-25(17-23)27(28,29)30)18-32-19-26(10-12-31-13-11-26)24-8-3-2-4-9-24/h2-9,14-17,31H,10-13,18-19H2,1H3 |
| InChIKey | PVXXVXKXEVALQK-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |