C18H32O4 — CID 24784662
2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol (PubChem CID 24784662) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is 2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol.
| Compound Name | 2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol |
|---|---|
| PubChem CID | 24784662 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol |
| SMILES | OCCC12CC3(CCO)CC(CCO)(C1)CC(CCO)(C2)C3 |
| InChI | InChI=1S/C18H32O4/c19-5-1-15-9-16(2-6-20)12-17(10-15,3-7-21)14-18(11-15,13-16)4-8-22/h19-22H,1-14H2 |
| InChIKey | WAMBQEDOVJEVFW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |