About 2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol
2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol (PubChem CID 24784662) has the molecular formula C18H32O4
and a molecular weight of 312.45 g/mol. Its IUPAC name is 2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol.
Molecular Properties
| Compound Name | 2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol |
| PubChem CID | 24784662 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol |
| SMILES | OCCC12CC3(CCO)CC(CCO)(C1)CC(CCO)(C2)C3 |
| InChI | InChI=1S/C18H32O4/c19-5-1-15-9-16(2-6-20)12-17(10-15,3-7-21)14-18(11-15,13-16)4-8-22/h19-22H,1-14H2 |
| InChIKey | WAMBQEDOVJEVFW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol?
The IUPAC name of 2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol (CID 24784662) is 2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol.
What is the SMILES notation for 2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol?
The canonical SMILES for 2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol is OCCC12CC3(CCO)CC(CCO)(C1)CC(CCO)(C2)C3.
What is the InChIKey of 2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol?
The InChIKey is WAMBQEDOVJEVFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O4/c19-5-1-15-9-16(2-6-20)12-17(10-15,3-7-21)14-18(11-15,13-16)4-8-22/h19-22H,1-14H2.
What are the key properties of 2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol?
2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol has a molecular weight of 312.45 g/mol, XLogP of 1.84, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5,7-tris(2-hydroxyethyl)-1-adamantyl]ethanol is sourced from PubChem (CID 24784662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).