C21H31N3O2 — CID 24784817
3-methyl-5-(propan-2-yloxymethyl)-1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrazole (PubChem CID 24784817) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 3-methyl-5-(propan-2-yloxymethyl)-1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrazole.
| Compound Name | 3-methyl-5-(propan-2-yloxymethyl)-1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrazole |
|---|---|
| PubChem CID | 24784817 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 3-methyl-5-(propan-2-yloxymethyl)-1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrazole |
| SMILES | Cc1cc(COC(C)C)n(-c2ccc(OCCCN3CCCC3)cc2)n1 |
| InChI | InChI=1S/C21H31N3O2/c1-17(2)26-16-20-15-18(3)22-24(20)19-7-9-21(10-8-19)25-14-6-13-23-11-4-5-12-23/h7-10,15,17H,4-6,11-14,16H2,1-3H3 |
| InChIKey | JEUDKMXENCTBEU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|