C22H35N3O — CID 90795397
1-[3-[4-[5-methyl-3-(2-methylpropyl)-3,4-dihydropyrazol-2-yl]phenoxy]propyl]piperidine (PubChem CID 90795397) has the molecular formula C22H35N3O and a molecular weight of 357.54 g/mol. Its IUPAC name is 1-[3-[4-[5-methyl-3-(2-methylpropyl)-3,4-dihydropyrazol-2-yl]phenoxy]propyl]piperidine.
| Compound Name | 1-[3-[4-[5-methyl-3-(2-methylpropyl)-3,4-dihydropyrazol-2-yl]phenoxy]propyl]piperidine |
|---|---|
| PubChem CID | 90795397 |
| Molecular Formula | C22H35N3O |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | 1-[3-[4-[5-methyl-3-(2-methylpropyl)-3,4-dihydropyrazol-2-yl]phenoxy]propyl]piperidine |
| SMILES | CC1=NN(c2ccc(OCCCN3CCCCC3)cc2)C(CC(C)C)C1 |
| InChI | InChI=1S/C22H35N3O/c1-18(2)16-21-17-19(3)23-25(21)20-8-10-22(11-9-20)26-15-7-14-24-12-5-4-6-13-24/h8-11,18,21H,4-7,12-17H2,1-3H3 |
| InChIKey | AHHGJTGOOVAXKL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|