C21H23N9OS — CID 24785537
(2S)-1-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]-2-methyl-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide (PubChem CID 24785537) has the molecular formula C21H23N9OS and a molecular weight of 449.54 g/mol. Its IUPAC name is (2S)-1-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]-2-methyl-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]-2-methyl-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24785537 |
| Molecular Formula | C21H23N9OS |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | (2S)-1-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]-2-methyl-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
| SMILES | C[C@@]1(C(=O)Nc2nccs2)CCCN1c1nc(Nc2cc(C3CC3)[nH]n2)c2cccn2n1 |
| InChI | InChI=1S/C21H23N9OS/c1-21(18(31)25-20-22-8-11-32-20)7-3-9-29(21)19-24-17(15-4-2-10-30(15)28-19)23-16-12-14(26-27-16)13-5-6-13/h2,4,8,10-13H,3,5-7,9H2,1H3,(H,22,25,31)(H2,23,24,26,27,28)/t21-/m0/s1 |
| InChIKey | CGMDMXYNDLBSNT-NRFANRHFSA-N |
| XLogP | 3.53 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |