C24H24Cl2N8O — CID 58277607
1-[(2S)-1-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]-2-methylpyrrolidin-2-yl]-2-(2,6-dichloro-3-pyridinyl)ethanone (PubChem CID 58277607) has the molecular formula C24H24Cl2N8O and a molecular weight of 511.42 g/mol. Its IUPAC name is 1-[(2S)-1-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]-2-methylpyrrolidin-2-yl]-2-(2,6-dichloro-3-pyridinyl)ethanone.
| Compound Name | 1-[(2S)-1-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]-2-methylpyrrolidin-2-yl]-2-(2,6-dichloro-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 58277607 |
| Molecular Formula | C24H24Cl2N8O |
| Molecular Weight | 511.42 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 1-[(2S)-1-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]-2-methylpyrrolidin-2-yl]-2-(2,6-dichloro-3-pyridinyl)ethanone |
| SMILES | C[C@@]1(C(=O)Cc2ccc(Cl)nc2Cl)CCCN1c1nc(Nc2cc(C3CC3)[nH]n2)c2cccn2n1 |
| InChI | InChI=1S/C24H24Cl2N8O/c1-24(18(35)12-15-7-8-19(25)27-21(15)26)9-3-10-33(24)23-29-22(17-4-2-11-34(17)32-23)28-20-13-16(30-31-20)14-5-6-14/h2,4,7-8,11,13-14H,3,5-6,9-10,12H2,1H3,(H2,28,29,30,31,32)/t24-/m0/s1 |
| InChIKey | VROMDYCAKNQLGO-DEOSSOPVSA-N |
| XLogP | 4.95 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|