C12H12F6O4 — CID 24786506
(3Z,7Z)-1,1,1,10,10,10-hexafluoro-4,7-dimethoxydeca-3,7-diene-2,9-dione (PubChem CID 24786506) has the molecular formula C12H12F6O4 and a molecular weight of 334.21 g/mol. Its IUPAC name is (3Z,7Z)-1,1,1,10,10,10-hexafluoro-4,7-dimethoxydeca-3,7-diene-2,9-dione.
| Compound Name | (3Z,7Z)-1,1,1,10,10,10-hexafluoro-4,7-dimethoxydeca-3,7-diene-2,9-dione |
|---|---|
| PubChem CID | 24786506 |
| Molecular Formula | C12H12F6O4 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (3Z,7Z)-1,1,1,10,10,10-hexafluoro-4,7-dimethoxydeca-3,7-diene-2,9-dione |
| SMILES | CO/C(=C\C(=O)C(F)(F)F)CC/C(=C/C(=O)C(F)(F)F)OC |
| InChI | InChI=1S/C12H12F6O4/c1-21-7(5-9(19)11(13,14)15)3-4-8(22-2)6-10(20)12(16,17)18/h5-6H,3-4H2,1-2H3/b7-5-,8-6- |
| InChIKey | BBNHJAWATJXCIR-SFECMWDFSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|