About 4-[(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxymethyl]benzonitrile
4-[(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxymethyl]benzonitrile (PubChem CID 2478656) has the molecular formula C19H13N5O
and a molecular weight of 327.35 g/mol. Its IUPAC name is 4-[(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxymethyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxymethyl]benzonitrile |
| PubChem CID | 2478656 |
| Molecular Formula | C19H13N5O |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 4-[(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxymethyl]benzonitrile |
| SMILES | N#Cc1ccc(COc2ncnc3c2cnn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H13N5O/c20-10-14-6-8-15(9-7-14)12-25-19-17-11-23-24(18(17)21-13-22-19)16-4-2-1-3-5-16/h1-9,11,13H,12H2 |
| InChIKey | OPYKWPYBLVXWOI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 76.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxymethyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxymethyl]benzonitrile?
The IUPAC name of 4-[(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxymethyl]benzonitrile (CID 2478656) is 4-[(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxymethyl]benzonitrile.
What is the SMILES notation for 4-[(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxymethyl]benzonitrile?
The canonical SMILES for 4-[(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxymethyl]benzonitrile is N#Cc1ccc(COc2ncnc3c2cnn3-c2ccccc2)cc1.
What is the InChIKey of 4-[(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxymethyl]benzonitrile?
The InChIKey is OPYKWPYBLVXWOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13N5O/c20-10-14-6-8-15(9-7-14)12-25-19-17-11-23-24(18(17)21-13-22-19)16-4-2-1-3-5-16/h1-9,11,13H,12H2.
What are the key properties of 4-[(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxymethyl]benzonitrile?
4-[(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxymethyl]benzonitrile has a molecular weight of 327.35 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)oxymethyl]benzonitrile is sourced from PubChem (CID 2478656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).