C39H36N2O3 — CID 24786904
1,3-dibenzyl-2-(4-methoxyphenyl)-4,5-bis(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate (PubChem CID 24786904) has the molecular formula C39H36N2O3 and a molecular weight of 580.73 g/mol. Its IUPAC name is 1,3-dibenzyl-2-(4-methoxyphenyl)-4,5-bis(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate.
| Compound Name | 1,3-dibenzyl-2-(4-methoxyphenyl)-4,5-bis(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate |
|---|---|
| PubChem CID | 24786904 |
| Molecular Formula | C39H36N2O3 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | 1,3-dibenzyl-2-(4-methoxyphenyl)-4,5-bis(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate |
| SMILES | COc1ccc(C2=[N+](Cc3ccccc3)C(c3ccc(C)cc3)C(C(=O)[O-])(c3ccc(C)cc3)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C39H36N2O3/c1-28-14-18-32(19-15-28)36-39(38(42)43,34-22-16-29(2)17-23-34)41(27-31-12-8-5-9-13-31)37(33-20-24-35(44-3)25-21-33)40(36)26-30-10-6-4-7-11-30/h4-25,36H,26-27H2,1-3H3 |
| InChIKey | CEWBFLMJKNXVTP-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|