C34H32N2O5 — CID 50941990
4-(1,3-benzodioxol-5-yl)-1-benzyl-3-ethyl-2-(4-methoxyphenyl)-5-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate (PubChem CID 50941990) has the molecular formula C34H32N2O5 and a molecular weight of 548.64 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-1-benzyl-3-ethyl-2-(4-methoxyphenyl)-5-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-1-benzyl-3-ethyl-2-(4-methoxyphenyl)-5-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate |
|---|---|
| PubChem CID | 50941990 |
| Molecular Formula | C34H32N2O5 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-1-benzyl-3-ethyl-2-(4-methoxyphenyl)-5-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate |
| SMILES | CC[N+]1=C(c2ccc(OC)cc2)N(Cc2ccccc2)C(C(=O)[O-])(c2ccc(C)cc2)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C34H32N2O5/c1-4-35-31(26-14-19-29-30(20-26)41-22-40-29)34(33(37)38,27-15-10-23(2)11-16-27)36(21-24-8-6-5-7-9-24)32(35)25-12-17-28(39-3)18-13-25/h5-20,31H,4,21-22H2,1-3H3 |
| InChIKey | DNTUHKZVFLJXQO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|