C39H32N2O6 — CID 50941894
(4R,5R)-4,5-bis(1,3-benzodioxol-5-yl)-1,3-dibenzyl-2-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate (PubChem CID 50941894) has the molecular formula C39H32N2O6 and a molecular weight of 624.69 g/mol. Its IUPAC name is (4R,5R)-4,5-bis(1,3-benzodioxol-5-yl)-1,3-dibenzyl-2-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate.
| Compound Name | (4R,5R)-4,5-bis(1,3-benzodioxol-5-yl)-1,3-dibenzyl-2-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate |
|---|---|
| PubChem CID | 50941894 |
| Molecular Formula | C39H32N2O6 |
| Molecular Weight | 624.69 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | (4R,5R)-4,5-bis(1,3-benzodioxol-5-yl)-1,3-dibenzyl-2-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate |
| SMILES | Cc1ccc(C2=[N+](Cc3ccccc3)[C@H](c3ccc4c(c3)OCO4)[C@@](C(=O)[O-])(c3ccc4c(c3)OCO4)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C39H32N2O6/c1-26-12-14-29(15-13-26)37-40(22-27-8-4-2-5-9-27)36(30-16-18-32-34(20-30)46-24-44-32)39(38(42)43,41(37)23-28-10-6-3-7-11-28)31-17-19-33-35(21-31)47-25-45-33/h2-21,36H,22-25H2,1H3/t36-,39-/m1/s1 |
| InChIKey | CGYZPVZUOIONDM-AEGYFVCZSA-N |
| XLogP | 5.31 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.69 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|