C38H35N2O4+ — CID 50942165
3-benzyl-1-[(3,4-dimethoxyphenyl)methyl]-2,4,5-triphenyl-4H-imidazol-3-ium-5-carboxylic acid (PubChem CID 50942165) has the molecular formula C38H35N2O4+ and a molecular weight of 583.71 g/mol. Its IUPAC name is 3-benzyl-1-[(3,4-dimethoxyphenyl)methyl]-2,4,5-triphenyl-4H-imidazol-3-ium-5-carboxylic acid.
| Compound Name | 3-benzyl-1-[(3,4-dimethoxyphenyl)methyl]-2,4,5-triphenyl-4H-imidazol-3-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 50942165 |
| Molecular Formula | C38H35N2O4+ |
| Molecular Weight | 583.71 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | 3-benzyl-1-[(3,4-dimethoxyphenyl)methyl]-2,4,5-triphenyl-4H-imidazol-3-ium-5-carboxylic acid |
| SMILES | COc1ccc(CN2C(c3ccccc3)=[N+](Cc3ccccc3)C(c3ccccc3)C2(C(=O)O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C38H34N2O4/c1-43-33-24-23-29(25-34(33)44-2)27-40-36(31-19-11-5-12-20-31)39(26-28-15-7-3-8-16-28)35(30-17-9-4-10-18-30)38(40,37(41)42)32-21-13-6-14-22-32/h3-25,35H,26-27H2,1-2H3/p+1 |
| InChIKey | OKYLRZQTUCOZPY-UHFFFAOYSA-O |
| XLogP | 6.90 |
| TPSA | 62.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.71 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|