C28H30N2O4 — CID 50942269
1-benzyl-3-(2-methoxyethyl)-2-(4-methoxyphenyl)-5-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate (PubChem CID 50942269) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is 1-benzyl-3-(2-methoxyethyl)-2-(4-methoxyphenyl)-5-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate.
| Compound Name | 1-benzyl-3-(2-methoxyethyl)-2-(4-methoxyphenyl)-5-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate |
|---|---|
| PubChem CID | 50942269 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 1-benzyl-3-(2-methoxyethyl)-2-(4-methoxyphenyl)-5-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate |
| SMILES | COCC[N+]1=C(c2ccc(OC)cc2)N(Cc2ccccc2)C(C(=O)[O-])(c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C28H30N2O4/c1-21-9-13-24(14-10-21)28(27(31)32)20-29(17-18-33-2)26(23-11-15-25(34-3)16-12-23)30(28)19-22-7-5-4-6-8-22/h4-16H,17-20H2,1-3H3 |
| InChIKey | NEUKTLJRMAGDEW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|