C33H32N2O3 — CID 50942081
1-benzyl-2-(4-methoxyphenyl)-3-methyl-4-(3-methylphenyl)-5-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate (PubChem CID 50942081) has the molecular formula C33H32N2O3 and a molecular weight of 504.63 g/mol. Its IUPAC name is 1-benzyl-2-(4-methoxyphenyl)-3-methyl-4-(3-methylphenyl)-5-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate.
| Compound Name | 1-benzyl-2-(4-methoxyphenyl)-3-methyl-4-(3-methylphenyl)-5-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate |
|---|---|
| PubChem CID | 50942081 |
| Molecular Formula | C33H32N2O3 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 1-benzyl-2-(4-methoxyphenyl)-3-methyl-4-(3-methylphenyl)-5-(4-methylphenyl)-4H-imidazol-3-ium-5-carboxylate |
| SMILES | COc1ccc(C2=[N+](C)C(c3cccc(C)c3)C(C(=O)[O-])(c3ccc(C)cc3)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C33H32N2O3/c1-23-13-17-28(18-14-23)33(32(36)37)30(27-12-8-9-24(2)21-27)34(3)31(26-15-19-29(38-4)20-16-26)35(33)22-25-10-6-5-7-11-25/h5-21,30H,22H2,1-4H3 |
| InChIKey | MUXUKBMTKTVYCM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|