C37H32N2O4 — CID 135002753
3-benzyl-1-(3,4-dimethoxyphenyl)-2,4,5-triphenyl-4H-imidazol-3-ium-5-carboxylate (PubChem CID 135002753) has the molecular formula C37H32N2O4 and a molecular weight of 568.67 g/mol. Its IUPAC name is 3-benzyl-1-(3,4-dimethoxyphenyl)-2,4,5-triphenyl-4H-imidazol-3-ium-5-carboxylate.
| Compound Name | 3-benzyl-1-(3,4-dimethoxyphenyl)-2,4,5-triphenyl-4H-imidazol-3-ium-5-carboxylate |
|---|---|
| PubChem CID | 135002753 |
| Molecular Formula | C37H32N2O4 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 3-benzyl-1-(3,4-dimethoxyphenyl)-2,4,5-triphenyl-4H-imidazol-3-ium-5-carboxylate |
| SMILES | COc1ccc(N2C(c3ccccc3)=[N+](Cc3ccccc3)C(c3ccccc3)C2(C(=O)[O-])c2ccccc2)cc1OC |
| InChI | InChI=1S/C37H32N2O4/c1-42-32-24-23-31(25-33(32)43-2)39-35(29-19-11-5-12-20-29)38(26-27-15-7-3-8-16-27)34(28-17-9-4-10-18-28)37(39,36(40)41)30-21-13-6-14-22-30/h3-25,34H,26H2,1-2H3 |
| InChIKey | YSMWZBCCYXREDU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|