C37H33N2O4+ — CID 135002754
3-benzyl-1-(3,4-dimethoxyphenyl)-2,4,5-triphenyl-4H-imidazol-3-ium-5-carboxylic acid (PubChem CID 135002754) has the molecular formula C37H33N2O4+ and a molecular weight of 569.68 g/mol. Its IUPAC name is 3-benzyl-1-(3,4-dimethoxyphenyl)-2,4,5-triphenyl-4H-imidazol-3-ium-5-carboxylic acid.
| Compound Name | 3-benzyl-1-(3,4-dimethoxyphenyl)-2,4,5-triphenyl-4H-imidazol-3-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 135002754 |
| Molecular Formula | C37H33N2O4+ |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | 3-benzyl-1-(3,4-dimethoxyphenyl)-2,4,5-triphenyl-4H-imidazol-3-ium-5-carboxylic acid |
| SMILES | COc1ccc(N2C(c3ccccc3)=[N+](Cc3ccccc3)C(c3ccccc3)C2(C(=O)O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C37H32N2O4/c1-42-32-24-23-31(25-33(32)43-2)39-35(29-19-11-5-12-20-29)38(26-27-15-7-3-8-16-27)34(28-17-9-4-10-18-28)37(39,36(40)41)30-21-13-6-14-22-30/h3-25,34H,26H2,1-2H3/p+1 |
| InChIKey | YSMWZBCCYXREDU-UHFFFAOYSA-O |
| XLogP | 6.90 |
| TPSA | 62.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|