C25H25N2O3+ — CID 50942276
5-(4-methoxyphenyl)-3-methyl-2-(4-methylphenyl)-1-phenyl-4H-imidazol-3-ium-5-carboxylic acid (PubChem CID 50942276) has the molecular formula C25H25N2O3+ and a molecular weight of 401.49 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-3-methyl-2-(4-methylphenyl)-1-phenyl-4H-imidazol-3-ium-5-carboxylic acid.
| Compound Name | 5-(4-methoxyphenyl)-3-methyl-2-(4-methylphenyl)-1-phenyl-4H-imidazol-3-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 50942276 |
| Molecular Formula | C25H25N2O3+ |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 5-(4-methoxyphenyl)-3-methyl-2-(4-methylphenyl)-1-phenyl-4H-imidazol-3-ium-5-carboxylic acid |
| SMILES | COc1ccc(C2(C(=O)O)C[N+](C)=C(c3ccc(C)cc3)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N2O3/c1-18-9-11-19(12-10-18)23-26(2)17-25(24(28)29,20-13-15-22(30-3)16-14-20)27(23)21-7-5-4-6-8-21/h4-16H,17H2,1-3H3/p+1 |
| InChIKey | VDFGNJGBKRHDSH-UHFFFAOYSA-O |
| XLogP | 3.89 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|