C37H32BrN2O3+ — CID 50941993
1-benzyl-4-(4-bromophenyl)-2-(4-methoxyphenyl)-5-(4-methylphenyl)-3-phenyl-4H-imidazol-1-ium-5-carboxylic acid (PubChem CID 50941993) has the molecular formula C37H32BrN2O3+ and a molecular weight of 632.58 g/mol. Its IUPAC name is 1-benzyl-4-(4-bromophenyl)-2-(4-methoxyphenyl)-5-(4-methylphenyl)-3-phenyl-4H-imidazol-1-ium-5-carboxylic acid.
| Compound Name | 1-benzyl-4-(4-bromophenyl)-2-(4-methoxyphenyl)-5-(4-methylphenyl)-3-phenyl-4H-imidazol-1-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 50941993 |
| Molecular Formula | C37H32BrN2O3+ |
| Molecular Weight | 632.58 g/mol |
| Exact Mass | 631.16 |
| IUPAC Name | 1-benzyl-4-(4-bromophenyl)-2-(4-methoxyphenyl)-5-(4-methylphenyl)-3-phenyl-4H-imidazol-1-ium-5-carboxylic acid |
| SMILES | COc1ccc(C2=[N+](Cc3ccccc3)C(C(=O)O)(c3ccc(C)cc3)C(c3ccc(Br)cc3)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C37H31BrN2O3/c1-26-13-19-30(20-14-26)37(36(41)42)34(28-15-21-31(38)22-16-28)40(32-11-7-4-8-12-32)35(29-17-23-33(43-2)24-18-29)39(37)25-27-9-5-3-6-10-27/h3-24,34H,25H2,1-2H3/p+1 |
| InChIKey | JLVSBFJZRUKOFR-UHFFFAOYSA-O |
| XLogP | 7.97 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.58 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|