C37H32N2O3 — CID 50941255
3-benzyl-1-[(4-methoxyphenyl)methyl]-2,4,5-triphenyl-4H-imidazol-3-ium-5-carboxylate (PubChem CID 50941255) has the molecular formula C37H32N2O3 and a molecular weight of 552.67 g/mol. Its IUPAC name is 3-benzyl-1-[(4-methoxyphenyl)methyl]-2,4,5-triphenyl-4H-imidazol-3-ium-5-carboxylate.
| Compound Name | 3-benzyl-1-[(4-methoxyphenyl)methyl]-2,4,5-triphenyl-4H-imidazol-3-ium-5-carboxylate |
|---|---|
| PubChem CID | 50941255 |
| Molecular Formula | C37H32N2O3 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 3-benzyl-1-[(4-methoxyphenyl)methyl]-2,4,5-triphenyl-4H-imidazol-3-ium-5-carboxylate |
| SMILES | COc1ccc(CN2C(c3ccccc3)=[N+](Cc3ccccc3)C(c3ccccc3)C2(C(=O)[O-])c2ccccc2)cc1 |
| InChI | InChI=1S/C37H32N2O3/c1-42-33-24-22-29(23-25-33)27-39-35(31-18-10-4-11-19-31)38(26-28-14-6-2-7-15-28)34(30-16-8-3-9-17-30)37(39,36(40)41)32-20-12-5-13-21-32/h2-25,34H,26-27H2,1H3 |
| InChIKey | OZUQTDZFZIFUJK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|