C16H14F6N2O — CID 24788547
1-[2,8-bis(trifluoromethyl)quinolin-4-yl]piperidin-3-ol (PubChem CID 24788547) has the molecular formula C16H14F6N2O and a molecular weight of 364.29 g/mol. Its IUPAC name is 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]piperidin-3-ol.
| Compound Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 24788547 |
| Molecular Formula | C16H14F6N2O |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]piperidin-3-ol |
| SMILES | OC1CCCN(c2cc(C(F)(F)F)nc3c(C(F)(F)F)cccc23)C1 |
| InChI | InChI=1S/C16H14F6N2O/c17-15(18,19)11-5-1-4-10-12(24-6-2-3-9(25)8-24)7-13(16(20,21)22)23-14(10)11/h1,4-5,7,9,25H,2-3,6,8H2 |
| InChIKey | OUJJSWIIFQTAKA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |