C29H29N3O — CID 24788947
4-cyclohexyl-N-[2-methyl-3-(5-phenyl-1H-imidazol-2-yl)phenyl]benzamide (PubChem CID 24788947) has the molecular formula C29H29N3O and a molecular weight of 435.57 g/mol. Its IUPAC name is 4-cyclohexyl-N-[2-methyl-3-(5-phenyl-1H-imidazol-2-yl)phenyl]benzamide.
| Compound Name | 4-cyclohexyl-N-[2-methyl-3-(5-phenyl-1H-imidazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 24788947 |
| Molecular Formula | C29H29N3O |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 4-cyclohexyl-N-[2-methyl-3-(5-phenyl-1H-imidazol-2-yl)phenyl]benzamide |
| SMILES | Cc1c(NC(=O)c2ccc(C3CCCCC3)cc2)cccc1-c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C29H29N3O/c1-20-25(28-30-19-27(31-28)23-11-6-3-7-12-23)13-8-14-26(20)32-29(33)24-17-15-22(16-18-24)21-9-4-2-5-10-21/h3,6-8,11-19,21H,2,4-5,9-10H2,1H3,(H,30,31)(H,32,33) |
| InChIKey | KPIPNVDDBKMDEV-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |