C26H34N2O2 — CID 24789325
N-benzyl-2-[(3R,4R)-1-(4-hexylphenyl)-4-methyl-2-oxopyrrolidin-3-yl]acetamide (PubChem CID 24789325) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is N-benzyl-2-[(3R,4R)-1-(4-hexylphenyl)-4-methyl-2-oxopyrrolidin-3-yl]acetamide.
| Compound Name | N-benzyl-2-[(3R,4R)-1-(4-hexylphenyl)-4-methyl-2-oxopyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 24789325 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | N-benzyl-2-[(3R,4R)-1-(4-hexylphenyl)-4-methyl-2-oxopyrrolidin-3-yl]acetamide |
| SMILES | CCCCCCc1ccc(N2C[C@H](C)[C@@H](CC(=O)NCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C26H34N2O2/c1-3-4-5-7-10-21-13-15-23(16-14-21)28-19-20(2)24(26(28)30)17-25(29)27-18-22-11-8-6-9-12-22/h6,8-9,11-16,20,24H,3-5,7,10,17-19H2,1-2H3,(H,27,29)/t20-,24+/m0/s1 |
| InChIKey | VBDFPOUKJZHTBW-GBXCKJPGSA-N |
| XLogP | 5.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|