C21H32N4O5S — CID 24789953
ethyl 4-[3-(1-phenylethylcarbamoyl)piperidin-1-yl]sulfonylpiperazine-1-carboxylate (PubChem CID 24789953) has the molecular formula C21H32N4O5S and a molecular weight of 452.58 g/mol. Its IUPAC name is ethyl 4-[3-(1-phenylethylcarbamoyl)piperidin-1-yl]sulfonylpiperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-(1-phenylethylcarbamoyl)piperidin-1-yl]sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 24789953 |
| Molecular Formula | C21H32N4O5S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | ethyl 4-[3-(1-phenylethylcarbamoyl)piperidin-1-yl]sulfonylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)N2CCCC(C(=O)NC(C)c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C21H32N4O5S/c1-3-30-21(27)23-12-14-24(15-13-23)31(28,29)25-11-7-10-19(16-25)20(26)22-17(2)18-8-5-4-6-9-18/h4-6,8-9,17,19H,3,7,10-16H2,1-2H3,(H,22,26) |
| InChIKey | YHMLOTAMGXTYGP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |