C26H29FN4O — CID 24791152
N-[3-(3-fluorophenyl)phenyl]-1-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]piperidine-4-carboxamide (PubChem CID 24791152) has the molecular formula C26H29FN4O and a molecular weight of 432.54 g/mol. Its IUPAC name is N-[3-(3-fluorophenyl)phenyl]-1-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[3-(3-fluorophenyl)phenyl]-1-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 24791152 |
| Molecular Formula | C26H29FN4O |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | N-[3-(3-fluorophenyl)phenyl]-1-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]piperidine-4-carboxamide |
| SMILES | C=CCn1cc(CN2CCC(C(=O)Nc3cccc(-c4cccc(F)c4)c3)CC2)c(C)n1 |
| InChI | InChI=1S/C26H29FN4O/c1-3-12-31-18-23(19(2)29-31)17-30-13-10-20(11-14-30)26(32)28-25-9-5-7-22(16-25)21-6-4-8-24(27)15-21/h3-9,15-16,18,20H,1,10-14,17H2,2H3,(H,28,32) |
| InChIKey | UIKPUZFLXMCXPJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|