C18H15FN4O2S — CID 24792434
N-[2-(benzylamino)-2-oxoethyl]-N-(2-fluorophenyl)thiadiazole-4-carboxamide (PubChem CID 24792434) has the molecular formula C18H15FN4O2S and a molecular weight of 370.41 g/mol. Its IUPAC name is N-[2-(benzylamino)-2-oxoethyl]-N-(2-fluorophenyl)thiadiazole-4-carboxamide.
| Compound Name | N-[2-(benzylamino)-2-oxoethyl]-N-(2-fluorophenyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 24792434 |
| Molecular Formula | C18H15FN4O2S |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-[2-(benzylamino)-2-oxoethyl]-N-(2-fluorophenyl)thiadiazole-4-carboxamide |
| SMILES | O=C(CN(C(=O)c1csnn1)c1ccccc1F)NCc1ccccc1 |
| InChI | InChI=1S/C18H15FN4O2S/c19-14-8-4-5-9-16(14)23(18(25)15-12-26-22-21-15)11-17(24)20-10-13-6-2-1-3-7-13/h1-9,12H,10-11H2,(H,20,24) |
| InChIKey | WEYJYTADDDGGPI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |