C19H17ClN4O2S — CID 1445672
N-[2-(benzylamino)-2-oxoethyl]-N-[(2-chlorophenyl)methyl]thiadiazole-4-carboxamide (PubChem CID 1445672) has the molecular formula C19H17ClN4O2S and a molecular weight of 400.89 g/mol. Its IUPAC name is N-[2-(benzylamino)-2-oxoethyl]-N-[(2-chlorophenyl)methyl]thiadiazole-4-carboxamide.
| Compound Name | N-[2-(benzylamino)-2-oxoethyl]-N-[(2-chlorophenyl)methyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 1445672 |
| Molecular Formula | C19H17ClN4O2S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N-[2-(benzylamino)-2-oxoethyl]-N-[(2-chlorophenyl)methyl]thiadiazole-4-carboxamide |
| SMILES | O=C(CN(Cc1ccccc1Cl)C(=O)c1csnn1)NCc1ccccc1 |
| InChI | InChI=1S/C19H17ClN4O2S/c20-16-9-5-4-8-15(16)11-24(19(26)17-13-27-23-22-17)12-18(25)21-10-14-6-2-1-3-7-14/h1-9,13H,10-12H2,(H,21,25) |
| InChIKey | MBYVNUVQFXIRDY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |