C20H23ClN4O2S — CID 3219478
N-[1-(4-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-prop-2-enylthiadiazole-4-carboxamide (PubChem CID 3219478) has the molecular formula C20H23ClN4O2S and a molecular weight of 418.95 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-prop-2-enylthiadiazole-4-carboxamide.
| Compound Name | N-[1-(4-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-prop-2-enylthiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 3219478 |
| Molecular Formula | C20H23ClN4O2S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-N-prop-2-enylthiadiazole-4-carboxamide |
| SMILES | C=CCN(C(=O)c1csnn1)C(C(=O)NC1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23ClN4O2S/c1-2-12-25(20(27)17-13-28-24-23-17)18(14-8-10-15(21)11-9-14)19(26)22-16-6-4-3-5-7-16/h2,8-11,13,16,18H,1,3-7,12H2,(H,22,26) |
| InChIKey | IHSYHSYXSLQGSS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|