C13H11FN6OS — CID 24792449
2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-(2-fluorophenyl)acetamide (PubChem CID 24792449) has the molecular formula C13H11FN6OS and a molecular weight of 318.34 g/mol. Its IUPAC name is 2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 24792449 |
| Molecular Formula | C13H11FN6OS |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-(2-fluorophenyl)acetamide |
| SMILES | Nc1ncnc2nc(SCC(=O)Nc3ccccc3F)[nH]c12 |
| InChI | InChI=1S/C13H11FN6OS/c14-7-3-1-2-4-8(7)18-9(21)5-22-13-19-10-11(15)16-6-17-12(10)20-13/h1-4,6H,5H2,(H,18,21)(H3,15,16,17,19,20) |
| InChIKey | MZOLDIJWFLWNOU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |