C19H24N2OS — CID 24793203
[3-[benzyl(methyl)amino]piperidin-1-yl]-(3-methylthiophen-2-yl)methanone (PubChem CID 24793203) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is [3-[benzyl(methyl)amino]piperidin-1-yl]-(3-methylthiophen-2-yl)methanone.
| Compound Name | [3-[benzyl(methyl)amino]piperidin-1-yl]-(3-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 24793203 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [3-[benzyl(methyl)amino]piperidin-1-yl]-(3-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccsc1C(=O)N1CCCC(N(C)Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H24N2OS/c1-15-10-12-23-18(15)19(22)21-11-6-9-17(14-21)20(2)13-16-7-4-3-5-8-16/h3-5,7-8,10,12,17H,6,9,11,13-14H2,1-2H3 |
| InChIKey | XMGMCHCYJKQRJP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |