C23H24FN3O4 — CID 24793842
N-[1-(2-fluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]-3,4,5-trimethoxybenzamide (PubChem CID 24793842) has the molecular formula C23H24FN3O4 and a molecular weight of 425.46 g/mol. Its IUPAC name is N-[1-(2-fluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[1-(2-fluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 24793842 |
| Molecular Formula | C23H24FN3O4 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-[1-(2-fluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC2CCCc3c2cnn3-c2ccccc2F)cc(OC)c1OC |
| InChI | InChI=1S/C23H24FN3O4/c1-29-20-11-14(12-21(30-2)22(20)31-3)23(28)26-17-8-6-10-18-15(17)13-25-27(18)19-9-5-4-7-16(19)24/h4-5,7,9,11-13,17H,6,8,10H2,1-3H3,(H,26,28) |
| InChIKey | VLDXHWXPIYVRSQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |