C23H30N2O5 — CID 24793925
methyl 1-[3-[1-(cyclopropanecarbonyl)piperidin-4-yl]oxybenzoyl]piperidine-2-carboxylate (PubChem CID 24793925) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is methyl 1-[3-[1-(cyclopropanecarbonyl)piperidin-4-yl]oxybenzoyl]piperidine-2-carboxylate.
| Compound Name | methyl 1-[3-[1-(cyclopropanecarbonyl)piperidin-4-yl]oxybenzoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 24793925 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | methyl 1-[3-[1-(cyclopropanecarbonyl)piperidin-4-yl]oxybenzoyl]piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1C(=O)c1cccc(OC2CCN(C(=O)C3CC3)CC2)c1 |
| InChI | InChI=1S/C23H30N2O5/c1-29-23(28)20-7-2-3-12-25(20)22(27)17-5-4-6-19(15-17)30-18-10-13-24(14-11-18)21(26)16-8-9-16/h4-6,15-16,18,20H,2-3,7-14H2,1H3 |
| InChIKey | GPAXWFPUMNSOBD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |