C22H30N2O6 — CID 24790521
methyl 1-[4-(1-acetylpiperidin-4-yl)oxy-3-methoxybenzoyl]piperidine-2-carboxylate (PubChem CID 24790521) has the molecular formula C22H30N2O6 and a molecular weight of 418.49 g/mol. Its IUPAC name is methyl 1-[4-(1-acetylpiperidin-4-yl)oxy-3-methoxybenzoyl]piperidine-2-carboxylate.
| Compound Name | methyl 1-[4-(1-acetylpiperidin-4-yl)oxy-3-methoxybenzoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 24790521 |
| Molecular Formula | C22H30N2O6 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | methyl 1-[4-(1-acetylpiperidin-4-yl)oxy-3-methoxybenzoyl]piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1C(=O)c1ccc(OC2CCN(C(C)=O)CC2)c(OC)c1 |
| InChI | InChI=1S/C22H30N2O6/c1-15(25)23-12-9-17(10-13-23)30-19-8-7-16(14-20(19)28-2)21(26)24-11-5-4-6-18(24)22(27)29-3/h7-8,14,17-18H,4-6,9-13H2,1-3H3 |
| InChIKey | HDCSWCQFFVYNDS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |