C44H50O10 — CID 24795260
[(2R,3R,4R,5S)-4-ethenyl-2-[(2R,3R,4R,5S,6S)-2-methoxy-6-methyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate (PubChem CID 24795260) has the molecular formula C44H50O10 and a molecular weight of 738.87 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-4-ethenyl-2-[(2R,3R,4R,5S,6S)-2-methoxy-6-methyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S)-4-ethenyl-2-[(2R,3R,4R,5S,6S)-2-methoxy-6-methyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 24795260 |
| Molecular Formula | C44H50O10 |
| Molecular Weight | 738.87 g/mol |
| Exact Mass | 738.34 |
| IUPAC Name | [(2R,3R,4R,5S)-4-ethenyl-2-[(2R,3R,4R,5S,6S)-2-methoxy-6-methyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate |
| SMILES | C=C[C@@]1(OCc2ccccc2)[C@H](COCc2ccccc2)O[C@@H](O[C@@H]2[C@@H](OCc3ccccc3)[C@H](C)O[C@@H](OC)[C@@H]2OCc2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C44H50O10/c1-5-44(50-29-36-24-16-9-17-25-36)37(30-47-26-33-18-10-6-11-19-33)53-43(41(44)52-32(3)45)54-39-38(48-27-34-20-12-7-13-21-34)31(2)51-42(46-4)40(39)49-28-35-22-14-8-15-23-35/h5-25,31,37-43H,1,26-30H2,2-4H3/t31-,37-,38-,39+,40+,41-,42+,43-,44+/m0/s1 |
| InChIKey | SWCXBFDBNZBDJU-UDAUXFIHSA-N |
| XLogP | 6.95 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.87 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|