C31H42O12 — CID 24795293
3,6,7-tri(butan-2-yloxy)-1-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one (PubChem CID 24795293) has the molecular formula C31H42O12 and a molecular weight of 606.67 g/mol. Its IUPAC name is 3,6,7-tri(butan-2-yloxy)-1-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one.
| Compound Name | 3,6,7-tri(butan-2-yloxy)-1-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one |
|---|---|
| PubChem CID | 24795293 |
| Molecular Formula | C31H42O12 |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | 3,6,7-tri(butan-2-yloxy)-1-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one |
| SMILES | CCC(C)Oc1cc2oc3cc(OC(C)CC)c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c(O)c3c(=O)c2cc1OC(C)CC |
| InChI | InChI=1S/C31H42O12/c1-7-14(4)38-19-10-17-18(11-20(19)39-15(5)8-2)41-21-12-22(40-16(6)9-3)30(27(35)24(21)25(17)33)43-31-29(37)28(36)26(34)23(13-32)42-31/h10-12,14-16,23,26,28-29,31-32,34-37H,7-9,13H2,1-6H3/t14?,15?,16?,23-,26-,28+,29-,31+/m1/s1 |
| InChIKey | PHJUSNLSOWFJIA-KRWFIKJASA-N |
| XLogP | 3.36 |
| TPSA | 177.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|