C26H30O14 — CID 90657927
2-[2,4-dimethoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-5-hydroxy-3,6,7-trimethoxychromen-4-one (PubChem CID 90657927) has the molecular formula C26H30O14 and a molecular weight of 566.51 g/mol. Its IUPAC name is 2-[2,4-dimethoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-5-hydroxy-3,6,7-trimethoxychromen-4-one.
| Compound Name | 2-[2,4-dimethoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-5-hydroxy-3,6,7-trimethoxychromen-4-one |
|---|---|
| PubChem CID | 90657927 |
| Molecular Formula | C26H30O14 |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | 2-[2,4-dimethoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-5-hydroxy-3,6,7-trimethoxychromen-4-one |
| SMILES | COc1ccc(-c2oc3cc(OC)c(OC)c(O)c3c(=O)c2OC)c(OC)c1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H30O14/c1-33-11-7-6-10(21(35-3)24(11)40-26-20(32)19(31)16(28)14(9-27)39-26)22-25(37-5)18(30)15-12(38-22)8-13(34-2)23(36-4)17(15)29/h6-8,14,16,19-20,26-29,31-32H,9H2,1-5H3/t14-,16-,19+,20-,26+/m1/s1 |
| InChIKey | WMFKOOZSWDLSGH-SMEJDQOCSA-N |
| XLogP | 0.39 |
| TPSA | 195.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |