C15H18O4 — CID 24795836
[2-methoxy-1-(3-methylbut-2-enyl)-6-oxocyclohexa-2,4-dien-1-yl] prop-2-enoate (PubChem CID 24795836) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is [2-methoxy-1-(3-methylbut-2-enyl)-6-oxocyclohexa-2,4-dien-1-yl] prop-2-enoate.
| Compound Name | [2-methoxy-1-(3-methylbut-2-enyl)-6-oxocyclohexa-2,4-dien-1-yl] prop-2-enoate |
|---|---|
| PubChem CID | 24795836 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | [2-methoxy-1-(3-methylbut-2-enyl)-6-oxocyclohexa-2,4-dien-1-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC1(CC=C(C)C)C(=O)C=CC=C1OC |
| InChI | InChI=1S/C15H18O4/c1-5-14(17)19-15(10-9-11(2)3)12(16)7-6-8-13(15)18-4/h5-9H,1,10H2,2-4H3 |
| InChIKey | BSICLQDVKKVQPP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|