C11H16N2O5 — CID 24796865
(2S)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-methylidenepent-4-enoic acid (PubChem CID 24796865) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is (2S)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-methylidenepent-4-enoic acid.
| Compound Name | (2S)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-methylidenepent-4-enoic acid |
|---|---|
| PubChem CID | 24796865 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (2S)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-methylidenepent-4-enoic acid |
| SMILES | C=CC(=C)[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H16N2O5/c1-3-6(2)9(11(17)18)13-8(14)5-4-7(12)10(15)16/h3,7,9H,1-2,4-5,12H2,(H,13,14)(H,15,16)(H,17,18)/t7-,9-/m0/s1 |
| InChIKey | OYFFZHHPKZICIV-CBAPKCEASA-N |
| XLogP | -0.51 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|