C13H17F3N2O7 — CID 24795462
2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-methylidenepent-4-enoic acid;2,2,2-trifluoroacetic acid (PubChem CID 24795462) has the molecular formula C13H17F3N2O7 and a molecular weight of 370.28 g/mol. Its IUPAC name is 2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-methylidenepent-4-enoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-methylidenepent-4-enoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24795462 |
| Molecular Formula | C13H17F3N2O7 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-methylidenepent-4-enoic acid;2,2,2-trifluoroacetic acid |
| SMILES | C=CC(=C)C(NC(=O)CC[C@H](N)C(=O)O)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H16N2O5.C2HF3O2/c1-3-6(2)9(11(17)18)13-8(14)5-4-7(12)10(15)16;3-2(4,5)1(6)7/h3,7,9H,1-2,4-5,12H2,(H,13,14)(H,15,16)(H,17,18);(H,6,7)/t7-,9?;/m0./s1 |
| InChIKey | VSNIOTUMOANFJZ-MCNHTDSKSA-N |
| XLogP | 0.12 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|