C6H9F3N2O5S — CID 10731266
(2S)-2-amino-5-oxo-5-(trifluoromethylsulfonylamino)pentanoic acid (PubChem CID 10731266) has the molecular formula C6H9F3N2O5S and a molecular weight of 278.21 g/mol. Its IUPAC name is (2S)-2-amino-5-oxo-5-(trifluoromethylsulfonylamino)pentanoic acid.
| Compound Name | (2S)-2-amino-5-oxo-5-(trifluoromethylsulfonylamino)pentanoic acid |
|---|---|
| PubChem CID | 10731266 |
| Molecular Formula | C6H9F3N2O5S |
| Molecular Weight | 278.21 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | (2S)-2-amino-5-oxo-5-(trifluoromethylsulfonylamino)pentanoic acid |
| SMILES | N[C@@H](CCC(=O)NS(=O)(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C6H9F3N2O5S/c7-6(8,9)17(15,16)11-4(12)2-1-3(10)5(13)14/h3H,1-2,10H2,(H,11,12)(H,13,14)/t3-/m0/s1 |
| InChIKey | ZLHQHXZZFNKYID-VKHMYHEASA-N |
| XLogP | -0.86 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.21 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |